C14H12FNO5 — CID 54276619
(2,5-dihydroxypyrrol-1-yl) 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 54276619) has the molecular formula C14H12FNO5 and a molecular weight of 293.25 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 54276619 |
| Molecular Formula | C14H12FNO5 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C14H12FNO5/c15-10-3-1-9(2-4-10)11(17)5-8-14(20)21-16-12(18)6-7-13(16)19/h1-4,6-7,18-19H,5,8H2 |
| InChIKey | RNVYKWUDFVNDBU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |