C15H10N2O6 — CID 54301349
(2,5-dioxopyrrol-1-yl) 2-(2,5-dihydroxypyrrol-1-yl)benzoate (PubChem CID 54301349) has the molecular formula C15H10N2O6 and a molecular weight of 314.25 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 2-(2,5-dihydroxypyrrol-1-yl)benzoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 2-(2,5-dihydroxypyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 54301349 |
| Molecular Formula | C15H10N2O6 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 2-(2,5-dihydroxypyrrol-1-yl)benzoate |
| SMILES | O=C(ON1C(=O)C=CC1=O)c1ccccc1-n1c(O)ccc1O |
| InChI | InChI=1S/C15H10N2O6/c18-11-5-6-12(19)16(11)10-4-2-1-3-9(10)15(22)23-17-13(20)7-8-14(17)21/h1-8,18-19H |
| InChIKey | ZSJRFZURRWPBPL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|