About 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate
1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate (PubChem CID 91199337) has the molecular formula C13H11F2NO5
and a molecular weight of 299.23 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate.
Analyze 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate?
The IUPAC name of 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate (CID 91199337) is 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate.
What is the SMILES notation for 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate?
The canonical SMILES for 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate is CC(OC(=O)On1c(O)ccc1O)c1c(F)cccc1F.
What is the InChIKey of 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate?
The InChIKey is FFUUBAZVHUPWFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2NO5/c1-7(12-8(14)3-2-4-9(12)15)20-13(19)21-16-10(17)5-6-11(16)18/h2-7,17-18H,1H3.
What are the key properties of 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate?
1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate has a molecular weight of 299.23 g/mol, XLogP of 2.50, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-difluorophenyl)ethyl (2,5-dihydroxypyrrol-1-yl) carbonate is sourced from PubChem (CID 91199337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).