C13H12FNO5 — CID 91501565
(2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate (PubChem CID 91501565) has the molecular formula C13H12FNO5 and a molecular weight of 281.24 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate |
|---|---|
| PubChem CID | 91501565 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate |
| SMILES | CC(OC(=O)On1c(O)ccc1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FNO5/c1-8(9-2-4-10(14)5-3-9)19-13(18)20-15-11(16)6-7-12(15)17/h2-8,16-17H,1H3 |
| InChIKey | QCCJRBJFYYTJLH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |