About (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate
(2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate (PubChem CID 91501565) has the molecular formula C13H12FNO5
and a molecular weight of 281.24 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate |
| PubChem CID | 91501565 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate |
| SMILES | CC(OC(=O)On1c(O)ccc1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FNO5/c1-8(9-2-4-10(14)5-3-9)19-13(18)20-15-11(16)6-7-12(15)17/h2-8,16-17H,1H3 |
| InChIKey | QCCJRBJFYYTJLH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate (CID 91501565) is (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate is CC(OC(=O)On1c(O)ccc1O)c1ccc(F)cc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate?
The InChIKey is QCCJRBJFYYTJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO5/c1-8(9-2-4-10(14)5-3-9)19-13(18)20-15-11(16)6-7-12(15)17/h2-8,16-17H,1H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate?
(2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate has a molecular weight of 281.24 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 1-(4-fluorophenyl)ethyl carbonate is sourced from PubChem (CID 91501565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).