C11H8FNO4 — CID 91258146
(2,5-dihydroxypyrrol-1-yl) 2-fluorobenzoate (PubChem CID 91258146) has the molecular formula C11H8FNO4 and a molecular weight of 237.19 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-fluorobenzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-fluorobenzoate |
|---|---|
| PubChem CID | 91258146 |
| Molecular Formula | C11H8FNO4 |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-fluorobenzoate |
| SMILES | O=C(On1c(O)ccc1O)c1ccccc1F |
| InChI | InChI=1S/C11H8FNO4/c12-8-4-2-1-3-7(8)11(16)17-13-9(14)5-6-10(13)15/h1-6,14-15H |
| InChIKey | LDZQAFLVLRUDEH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |