C25H34BrN5O3 — CID 91971301
N-(3-bromophenyl)-N'-[2-[[(2S)-2,6-diaminohexanoyl]amino]phenyl]heptanediamide (PubChem CID 91971301) has the molecular formula C25H34BrN5O3 and a molecular weight of 532.48 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-[2-[[(2S)-2,6-diaminohexanoyl]amino]phenyl]heptanediamide.
| Compound Name | N-(3-bromophenyl)-N'-[2-[[(2S)-2,6-diaminohexanoyl]amino]phenyl]heptanediamide |
|---|---|
| PubChem CID | 91971301 |
| Molecular Formula | C25H34BrN5O3 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | N-(3-bromophenyl)-N'-[2-[[(2S)-2,6-diaminohexanoyl]amino]phenyl]heptanediamide |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccccc1NC(=O)CCCCCC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C25H34BrN5O3/c26-18-9-8-10-19(17-18)29-23(32)14-2-1-3-15-24(33)30-21-12-4-5-13-22(21)31-25(34)20(28)11-6-7-16-27/h4-5,8-10,12-13,17,20H,1-3,6-7,11,14-16,27-28H2,(H,29,32)(H,30,33)(H,31,34)/t20-/m0/s1 |
| InChIKey | WTPYVNDDNJVYFX-FQEVSTJZSA-N |
| XLogP | 4.37 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|