C28H27N3O — CID 70974540
2,6-diamino-N-[3,5-bis(2-phenylethynyl)phenyl]hexanamide (PubChem CID 70974540) has the molecular formula C28H27N3O and a molecular weight of 421.54 g/mol. Its IUPAC name is 2,6-diamino-N-[3,5-bis(2-phenylethynyl)phenyl]hexanamide.
| Compound Name | 2,6-diamino-N-[3,5-bis(2-phenylethynyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 70974540 |
| Molecular Formula | C28H27N3O |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2,6-diamino-N-[3,5-bis(2-phenylethynyl)phenyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)Nc1cc(C#Cc2ccccc2)cc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H27N3O/c29-18-8-7-13-27(30)28(32)31-26-20-24(16-14-22-9-3-1-4-10-22)19-25(21-26)17-15-23-11-5-2-6-12-23/h1-6,9-12,19-21,27H,7-8,13,18,29-30H2,(H,31,32) |
| InChIKey | ONHMYZMJOYJDCF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|