C20H29N3O — CID 59572049
2,6-diamino-N-[3-(2-cyclohexylethynyl)phenyl]hexanamide (PubChem CID 59572049) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 2,6-diamino-N-[3-(2-cyclohexylethynyl)phenyl]hexanamide.
| Compound Name | 2,6-diamino-N-[3-(2-cyclohexylethynyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 59572049 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2,6-diamino-N-[3-(2-cyclohexylethynyl)phenyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)Nc1cccc(C#CC2CCCCC2)c1 |
| InChI | InChI=1S/C20H29N3O/c21-14-5-4-11-19(22)20(24)23-18-10-6-9-17(15-18)13-12-16-7-2-1-3-8-16/h6,9-10,15-16,19H,1-5,7-8,11,14,21-22H2,(H,23,24) |
| InChIKey | WXRMXUMKUGEWGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|