C19H20Cl2F4N4O — CID 78078643
2,6-diamino-N-[3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide;dihydrochloride (PubChem CID 78078643) has the molecular formula C19H20Cl2F4N4O and a molecular weight of 467.29 g/mol. Its IUPAC name is 2,6-diamino-N-[3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide;dihydrochloride.
| Compound Name | 2,6-diamino-N-[3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 78078643 |
| Molecular Formula | C19H20Cl2F4N4O |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2,6-diamino-N-[3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCC(N)C(=O)Nc1cccc(C#Cc2c(F)c(F)nc(F)c2F)c1 |
| InChI | InChI=1S/C19H18F4N4O.2ClH/c20-15-13(16(21)18(23)27-17(15)22)8-7-11-4-3-5-12(10-11)26-19(28)14(25)6-1-2-9-24;;/h3-5,10,14H,1-2,6,9,24-25H2,(H,26,28);2*1H |
| InChIKey | XEEQXOLUYGMGMR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|