C20H19F4N5O2 — CID 134143150
(2S)-2-amino-5-[(2-aminoacetyl)amino]-N-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]pentanamide (PubChem CID 134143150) has the molecular formula C20H19F4N5O2 and a molecular weight of 437.40 g/mol. Its IUPAC name is (2S)-2-amino-5-[(2-aminoacetyl)amino]-N-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]pentanamide.
| Compound Name | (2S)-2-amino-5-[(2-aminoacetyl)amino]-N-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 134143150 |
| Molecular Formula | C20H19F4N5O2 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (2S)-2-amino-5-[(2-aminoacetyl)amino]-N-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]pentanamide |
| SMILES | NCC(=O)NCCC[C@H](N)C(=O)Nc1ccc(C#Cc2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C20H19F4N5O2/c21-16-13(17(22)19(24)29-18(16)23)8-5-11-3-6-12(7-4-11)28-20(31)14(26)2-1-9-27-15(30)10-25/h3-4,6-7,14H,1-2,9-10,25-26H2,(H,27,30)(H,28,31)/t14-/m0/s1 |
| InChIKey | LLHDIEMDXUMMOK-AWEZNQCLSA-N |
| XLogP | 1.16 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|