C19H18F4N6O2 — CID 71000853
2,3-diamino-N-[2-amino-3-oxo-3-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]anilino]propyl]propanamide (PubChem CID 71000853) has the molecular formula C19H18F4N6O2 and a molecular weight of 438.39 g/mol. Its IUPAC name is 2,3-diamino-N-[2-amino-3-oxo-3-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]anilino]propyl]propanamide.
| Compound Name | 2,3-diamino-N-[2-amino-3-oxo-3-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]anilino]propyl]propanamide |
|---|---|
| PubChem CID | 71000853 |
| Molecular Formula | C19H18F4N6O2 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2,3-diamino-N-[2-amino-3-oxo-3-[4-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]anilino]propyl]propanamide |
| SMILES | NCC(N)C(=O)NCC(N)C(=O)Nc1ccc(C#Cc2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C19H18F4N6O2/c20-14-11(15(21)17(23)29-16(14)22)6-3-9-1-4-10(5-2-9)28-19(31)13(26)8-27-18(30)12(25)7-24/h1-2,4-5,12-13H,7-8,24-26H2,(H,27,30)(H,28,31) |
| InChIKey | OWFMFYCMSXYRCW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|