C23H30N2O — CID 90884698
N-ethylethanamine;2-methyl-N-[4-(2-phenylethynyl)phenyl]butanamide (PubChem CID 90884698) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is N-ethylethanamine;2-methyl-N-[4-(2-phenylethynyl)phenyl]butanamide.
| Compound Name | N-ethylethanamine;2-methyl-N-[4-(2-phenylethynyl)phenyl]butanamide |
|---|---|
| PubChem CID | 90884698 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | N-ethylethanamine;2-methyl-N-[4-(2-phenylethynyl)phenyl]butanamide |
| SMILES | CCC(C)C(=O)Nc1ccc(C#Cc2ccccc2)cc1.CCNCC |
| InChI | InChI=1S/C19H19NO.C4H11N/c1-3-15(2)19(21)20-18-13-11-17(12-14-18)10-9-16-7-5-4-6-8-16;1-3-5-4-2/h4-8,11-15H,3H2,1-2H3,(H,20,21);5H,3-4H2,1-2H3 |
| InChIKey | WOMOHIGHPGDCAY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|