About (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride
(2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride (PubChem CID 164800166) has the molecular formula C17H21Cl2N5O
and a molecular weight of 382.30 g/mol. Its IUPAC name is (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride.
Molecular Properties
| Compound Name | (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride |
| PubChem CID | 164800166 |
| Molecular Formula | C17H21Cl2N5O |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride |
| SMILES | Cc1cccc(-n2ncc3ccc(NC(=O)[C@@H](N)CN)cc32)c1.Cl.Cl |
| InChI | InChI=1S/C17H19N5O.2ClH/c1-11-3-2-4-14(7-11)22-16-8-13(6-5-12(16)10-20-22)21-17(23)15(19)9-18;;/h2-8,10,15H,9,18-19H2,1H3,(H,21,23);2*1H/t15-;;/m0../s1 |
| InChIKey | FRRVAYWZWFCLMD-CKUXDGONSA-N |
| XLogP | 2.40 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride?
The IUPAC name of (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride (CID 164800166) is (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride.
What is the SMILES notation for (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride?
The canonical SMILES for (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride is Cc1cccc(-n2ncc3ccc(NC(=O)[C@@H](N)CN)cc32)c1.Cl.Cl.
What is the InChIKey of (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride?
The InChIKey is FRRVAYWZWFCLMD-CKUXDGONSA-N. The full InChI is InChI=1S/C17H19N5O.2ClH/c1-11-3-2-4-14(7-11)22-16-8-13(6-5-12(16)10-20-22)21-17(23)15(19)9-18;;/h2-8,10,15H,9,18-19H2,1H3,(H,21,23);2*1H/t15-;;/m0../s1.
What are the key properties of (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride?
(2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride has a molecular weight of 382.30 g/mol, XLogP of 2.40, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-diamino-N-[1-(3-methylphenyl)indazol-6-yl]propanamide;dihydrochloride is sourced from PubChem (CID 164800166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).