C14H21ClN4O — CID 119305696
2-amino-N-(1-ethylindazol-6-yl)pentanamide;hydrochloride (PubChem CID 119305696) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-amino-N-(1-ethylindazol-6-yl)pentanamide;hydrochloride.
| Compound Name | 2-amino-N-(1-ethylindazol-6-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119305696 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-amino-N-(1-ethylindazol-6-yl)pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)Nc1ccc2cnn(CC)c2c1.Cl |
| InChI | InChI=1S/C14H20N4O.ClH/c1-3-5-12(15)14(19)17-11-7-6-10-9-16-18(4-2)13(10)8-11;/h6-9,12H,3-5,15H2,1-2H3,(H,17,19);1H |
| InChIKey | IYOZTRXDWDJRCP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |