C13H16N4OS — CID 119305675
N-(1-ethylindazol-6-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 119305675) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is N-(1-ethylindazol-6-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(1-ethylindazol-6-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119305675 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(1-ethylindazol-6-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCn1ncc2ccc(NC(=O)C3CSCN3)cc21 |
| InChI | InChI=1S/C13H16N4OS/c1-2-17-12-5-10(4-3-9(12)6-15-17)16-13(18)11-7-19-8-14-11/h3-6,11,14H,2,7-8H2,1H3,(H,16,18) |
| InChIKey | VVSRGSBTWBEQIO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |