C15H20N4O2 — CID 120790106
(2S,5R)-5-(aminomethyl)-N-(1-ethylindazol-6-yl)oxolane-2-carboxamide (PubChem CID 120790106) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(1-ethylindazol-6-yl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(1-ethylindazol-6-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120790106 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(1-ethylindazol-6-yl)oxolane-2-carboxamide |
| SMILES | CCn1ncc2ccc(NC(=O)[C@@H]3CC[C@H](CN)O3)cc21 |
| InChI | InChI=1S/C15H20N4O2/c1-2-19-13-7-11(4-3-10(13)9-17-19)18-15(20)14-6-5-12(8-16)21-14/h3-4,7,9,12,14H,2,5-6,8,16H2,1H3,(H,18,20)/t12-,14+/m1/s1 |
| InChIKey | CRBBKBXZJRREDZ-OCCSQVGLSA-N |
| XLogP | 1.50 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |