C12H14BrFN2O2 — CID 120785826
(2S,5R)-5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)oxolane-2-carboxamide (PubChem CID 120785826) has the molecular formula C12H14BrFN2O2 and a molecular weight of 317.16 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120785826 |
| Molecular Formula | C12H14BrFN2O2 |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(4-bromo-3-fluorophenyl)oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)Nc2ccc(Br)c(F)c2)O1 |
| InChI | InChI=1S/C12H14BrFN2O2/c13-9-3-1-7(5-10(9)14)16-12(17)11-4-2-8(6-15)18-11/h1,3,5,8,11H,2,4,6,15H2,(H,16,17)/t8-,11+/m1/s1 |
| InChIKey | RXHYPGAGAWKPFM-KCJUWKMLSA-N |
| XLogP | 2.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |