C12H17ClN2O3 — CID 120801765
(2S,5R)-5-(aminomethyl)-N-(4-hydroxyphenyl)oxolane-2-carboxamide;hydrochloride (PubChem CID 120801765) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(4-hydroxyphenyl)oxolane-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(4-hydroxyphenyl)oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120801765 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(4-hydroxyphenyl)oxolane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC[C@H]1CC[C@@H](C(=O)Nc2ccc(O)cc2)O1 |
| InChI | InChI=1S/C12H16N2O3.ClH/c13-7-10-5-6-11(17-10)12(16)14-8-1-3-9(15)4-2-8;/h1-4,10-11,15H,5-7,13H2,(H,14,16);1H/t10-,11+;/m1./s1 |
| InChIKey | HJCORDJLYBRPGN-DHXVBOOMSA-N |
| XLogP | 1.26 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|