C15H19N3O2 — CID 120785796
(2S,5R)-5-(aminomethyl)-N-(2-methyl-1H-indol-5-yl)oxolane-2-carboxamide (PubChem CID 120785796) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(2-methyl-1H-indol-5-yl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(2-methyl-1H-indol-5-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120785796 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(2-methyl-1H-indol-5-yl)oxolane-2-carboxamide |
| SMILES | Cc1cc2cc(NC(=O)[C@@H]3CC[C@H](CN)O3)ccc2[nH]1 |
| InChI | InChI=1S/C15H19N3O2/c1-9-6-10-7-11(2-4-13(10)17-9)18-15(19)14-5-3-12(8-16)20-14/h2,4,6-7,12,14,17H,3,5,8,16H2,1H3,(H,18,19)/t12-,14+/m1/s1 |
| InChIKey | NLBGMMAXWAEDBB-OCCSQVGLSA-N |
| XLogP | 1.92 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |