C15H20N2O4 — CID 120782848
ethyl 4-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]benzoate (PubChem CID 120782848) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl 4-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 120782848 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 4-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H]2CC[C@H](CN)O2)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-2-20-15(19)10-3-5-11(6-4-10)17-14(18)13-8-7-12(9-16)21-13/h3-6,12-13H,2,7-9,16H2,1H3,(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | SFLLPKFAAXUDRE-OLZOCXBDSA-N |
| XLogP | 1.31 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |