C18H26N2O3 — CID 120793998
(2S,5R)-5-(aminomethyl)-N-(4-cyclohexyloxyphenyl)oxolane-2-carboxamide (PubChem CID 120793998) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(4-cyclohexyloxyphenyl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(4-cyclohexyloxyphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120793998 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(4-cyclohexyloxyphenyl)oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)Nc2ccc(OC3CCCCC3)cc2)O1 |
| InChI | InChI=1S/C18H26N2O3/c19-12-16-10-11-17(23-16)18(21)20-13-6-8-15(9-7-13)22-14-4-2-1-3-5-14/h6-9,14,16-17H,1-5,10-12,19H2,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | CZXCBEVCGYNQIV-SJORKVTESA-N |
| XLogP | 2.84 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |