C12H17ClN4O — CID 119752857
N-(1-ethylindazol-6-yl)-2-(methylamino)acetamide;hydrochloride (PubChem CID 119752857) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is N-(1-ethylindazol-6-yl)-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-(1-ethylindazol-6-yl)-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119752857 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-(1-ethylindazol-6-yl)-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCn1ncc2ccc(NC(=O)CNC)cc21.Cl |
| InChI | InChI=1S/C12H16N4O.ClH/c1-3-16-11-6-10(15-12(17)8-13-2)5-4-9(11)7-14-16;/h4-7,13H,3,8H2,1-2H3,(H,15,17);1H |
| InChIKey | LDQMBQOZAHYQES-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |