C18H23Cl2N5O — CID 155214434
2,4-diamino-N-[1-(3-methylphenyl)indazol-6-yl]butanamide;dihydrochloride (PubChem CID 155214434) has the molecular formula C18H23Cl2N5O and a molecular weight of 396.32 g/mol. Its IUPAC name is 2,4-diamino-N-[1-(3-methylphenyl)indazol-6-yl]butanamide;dihydrochloride.
| Compound Name | 2,4-diamino-N-[1-(3-methylphenyl)indazol-6-yl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 155214434 |
| Molecular Formula | C18H23Cl2N5O |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2,4-diamino-N-[1-(3-methylphenyl)indazol-6-yl]butanamide;dihydrochloride |
| SMILES | Cc1cccc(-n2ncc3ccc(NC(=O)C(N)CCN)cc32)c1.Cl.Cl |
| InChI | InChI=1S/C18H21N5O.2ClH/c1-12-3-2-4-15(9-12)23-17-10-14(6-5-13(17)11-21-23)22-18(24)16(20)7-8-19;;/h2-6,9-11,16H,7-8,19-20H2,1H3,(H,22,24);2*1H |
| InChIKey | SZHFRLSCWPQKOH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |