C23H26N4O4 — CID 164980151
tert-butyl N-[1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1,3-dioxobutan-2-yl]carbamate (PubChem CID 164980151) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1,3-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1,3-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 164980151 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl N-[1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1,3-dioxobutan-2-yl]carbamate |
| SMILES | CC(=O)C(NC(=O)OC(C)(C)C)C(=O)Nc1ccc2cnn(-c3cccc(C)c3)c2c1 |
| InChI | InChI=1S/C23H26N4O4/c1-14-7-6-8-18(11-14)27-19-12-17(10-9-16(19)13-24-27)25-21(29)20(15(2)28)26-22(30)31-23(3,4)5/h6-13,20H,1-5H3,(H,25,29)(H,26,30) |
| InChIKey | WBTVPAFACAJGSW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|