C30H34N4O5 — CID 167122488
[(2S)-2-(ethoxycarbonylamino)-3-[[1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] (E)-2-[(Z)-2-cyclobutylethenyl]but-2-enoate (PubChem CID 167122488) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is [(2S)-2-(ethoxycarbonylamino)-3-[[1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] (E)-2-[(Z)-2-cyclobutylethenyl]but-2-enoate.
| Compound Name | [(2S)-2-(ethoxycarbonylamino)-3-[[1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] (E)-2-[(Z)-2-cyclobutylethenyl]but-2-enoate |
|---|---|
| PubChem CID | 167122488 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | [(2S)-2-(ethoxycarbonylamino)-3-[[1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] (E)-2-[(Z)-2-cyclobutylethenyl]but-2-enoate |
| SMILES | C/C=C(\C=C/C1CCC1)C(=O)OC[C@H](NC(=O)OCC)C(=O)Nc1ccc2cnn(-c3cccc(C)c3)c2c1 |
| InChI | InChI=1S/C30H34N4O5/c1-4-22(13-12-21-9-7-10-21)29(36)39-19-26(33-30(37)38-5-2)28(35)32-24-15-14-23-18-31-34(27(23)17-24)25-11-6-8-20(3)16-25/h4,6,8,11-18,21,26H,5,7,9-10,19H2,1-3H3,(H,32,35)(H,33,37)/b13-12-,22-4+/t26-/m0/s1 |
| InChIKey | GAASHBZBGMRTCR-NACMAKMYSA-N |
| XLogP | 5.23 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|