C19H20N4O4 — CID 175194363
[(2S)-4-hydroxy-1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1-oxobutan-2-yl] carbamate (PubChem CID 175194363) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(2S)-4-hydroxy-1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1-oxobutan-2-yl] carbamate.
| Compound Name | [(2S)-4-hydroxy-1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1-oxobutan-2-yl] carbamate |
|---|---|
| PubChem CID | 175194363 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [(2S)-4-hydroxy-1-[[1-(3-methylphenyl)indazol-6-yl]amino]-1-oxobutan-2-yl] carbamate |
| SMILES | Cc1cccc(-n2ncc3ccc(NC(=O)[C@H](CCO)OC(N)=O)cc32)c1 |
| InChI | InChI=1S/C19H20N4O4/c1-12-3-2-4-15(9-12)23-16-10-14(6-5-13(16)11-21-23)22-18(25)17(7-8-24)27-19(20)26/h2-6,9-11,17,24H,7-8H2,1H3,(H2,20,26)(H,22,25)/t17-/m0/s1 |
| InChIKey | JMLMGIUKERLATF-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |