C25H34ClFN4O3S — CID 165092925
[(2S)-2-amino-3-[[4-fluoro-1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] octanoate;sulfane;hydrochloride (PubChem CID 165092925) has the molecular formula C25H34ClFN4O3S and a molecular weight of 525.09 g/mol. Its IUPAC name is [(2S)-2-amino-3-[[4-fluoro-1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] octanoate;sulfane;hydrochloride.
| Compound Name | [(2S)-2-amino-3-[[4-fluoro-1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] octanoate;sulfane;hydrochloride |
|---|---|
| PubChem CID | 165092925 |
| Molecular Formula | C25H34ClFN4O3S |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | [(2S)-2-amino-3-[[4-fluoro-1-(3-methylphenyl)indazol-6-yl]amino]-3-oxopropyl] octanoate;sulfane;hydrochloride |
| SMILES | CCCCCCCC(=O)OC[C@H](N)C(=O)Nc1cc(F)c2cnn(-c3cccc(C)c3)c2c1.Cl.S |
| InChI | InChI=1S/C25H31FN4O3.ClH.H2S/c1-3-4-5-6-7-11-24(31)33-16-22(27)25(32)29-18-13-21(26)20-15-28-30(23(20)14-18)19-10-8-9-17(2)12-19;;/h8-10,12-15,22H,3-7,11,16,27H2,1-2H3,(H,29,32);1H;1H2/t22-;;/m0../s1 |
| InChIKey | VPIFUOXOQUZIEE-IKXQUJFKSA-N |
| XLogP | 5.18 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|