C26H27F4N5O2 — CID 71003915
2-amino-6-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)phenyl]hexanamide (PubChem CID 71003915) has the molecular formula C26H27F4N5O2 and a molecular weight of 517.53 g/mol. Its IUPAC name is 2-amino-6-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)phenyl]hexanamide.
| Compound Name | 2-amino-6-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 71003915 |
| Molecular Formula | C26H27F4N5O2 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 2-amino-6-[(2-amino-3-phenylpropanoyl)amino]-N-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)phenyl]hexanamide |
| SMILES | NC(Cc1ccccc1)C(=O)NCCCCC(N)C(=O)Nc1ccc(-c2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C26H27F4N5O2/c27-21-20(22(28)24(30)35-23(21)29)16-9-11-17(12-10-16)34-26(37)18(31)8-4-5-13-33-25(36)19(32)14-15-6-2-1-3-7-15/h1-3,6-7,9-12,18-19H,4-5,8,13-14,31-32H2,(H,33,36)(H,34,37) |
| InChIKey | GBZFJTJTDXEBMU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|