C19H18F4N4O — CID 71000877
(2S)-2,6-diamino-N-[2-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide (PubChem CID 71000877) has the molecular formula C19H18F4N4O and a molecular weight of 394.37 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 71000877 |
| Molecular Formula | C19H18F4N4O |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)ethynyl]phenyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccccc1C#Cc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C19H18F4N4O/c20-15-12(16(21)18(23)27-17(15)22)9-8-11-5-1-2-7-14(11)26-19(28)13(25)6-3-4-10-24/h1-2,5,7,13H,3-4,6,10,24-25H2,(H,26,28)/t13-/m0/s1 |
| InChIKey | NWMLWNVDLGQIOB-ZDUSSCGKSA-N |
| XLogP | 2.43 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|