C26H29N5O2 — CID 21359233
(2S)-N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2,6-diaminohexanamide (PubChem CID 21359233) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is (2S)-N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2,6-diaminohexanamide.
| Compound Name | (2S)-N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2,6-diaminohexanamide |
|---|---|
| PubChem CID | 21359233 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (2S)-N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2,6-diaminohexanamide |
| SMILES | NCCCC[C@H](N)C(=O)Nc1cc(CO)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C26H29N5O2/c27-12-6-5-9-22(28)26(33)30-19-14-17(16-32)13-18(15-19)29-25-20-7-1-3-10-23(20)31-24-11-4-2-8-21(24)25/h1-4,7-8,10-11,13-15,22,32H,5-6,9,12,16,27-28H2,(H,29,31)(H,30,33)/t22-/m0/s1 |
| InChIKey | MOMBDLMRYOLCII-QFIPXVFZSA-N |
| XLogP | 4.02 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|