C26H26N6O4 — CID 53391565
4-(acridin-9-ylamino)-N-[(2S)-2,6-diaminohexanoyl]-3-nitrobenzamide (PubChem CID 53391565) has the molecular formula C26H26N6O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is 4-(acridin-9-ylamino)-N-[(2S)-2,6-diaminohexanoyl]-3-nitrobenzamide.
| Compound Name | 4-(acridin-9-ylamino)-N-[(2S)-2,6-diaminohexanoyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 53391565 |
| Molecular Formula | C26H26N6O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-(acridin-9-ylamino)-N-[(2S)-2,6-diaminohexanoyl]-3-nitrobenzamide |
| SMILES | NCCCC[C@H](N)C(=O)NC(=O)c1ccc(Nc2c3ccccc3nc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26N6O4/c27-14-6-5-9-19(28)26(34)31-25(33)16-12-13-22(23(15-16)32(35)36)30-24-17-7-1-3-10-20(17)29-21-11-4-2-8-18(21)24/h1-4,7-8,10-13,15,19H,5-6,9,14,27-28H2,(H,29,30)(H,31,33,34)/t19-/m0/s1 |
| InChIKey | ZGGQYWLMDOXVLR-IBGZPJMESA-N |
| XLogP | 3.75 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|