C43H31N9O7 — CID 88945678
4-(acridin-9-ylamino)-N-[2-[[4-(acridin-9-ylamino)-3-nitrobenzoyl]amino]-3-amino-3-oxopropyl]-3-nitrobenzamide (PubChem CID 88945678) has the molecular formula C43H31N9O7 and a molecular weight of 785.78 g/mol. Its IUPAC name is 4-(acridin-9-ylamino)-N-[2-[[4-(acridin-9-ylamino)-3-nitrobenzoyl]amino]-3-amino-3-oxopropyl]-3-nitrobenzamide.
| Compound Name | 4-(acridin-9-ylamino)-N-[2-[[4-(acridin-9-ylamino)-3-nitrobenzoyl]amino]-3-amino-3-oxopropyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 88945678 |
| Molecular Formula | C43H31N9O7 |
| Molecular Weight | 785.78 g/mol |
| Exact Mass | 785.23 |
| IUPAC Name | 4-(acridin-9-ylamino)-N-[2-[[4-(acridin-9-ylamino)-3-nitrobenzoyl]amino]-3-amino-3-oxopropyl]-3-nitrobenzamide |
| SMILES | NC(=O)C(CNC(=O)c1ccc(Nc2c3ccccc3nc3ccccc23)c([N+](=O)[O-])c1)NC(=O)c1ccc(Nc2c3ccccc3nc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C43H31N9O7/c44-41(53)36(50-43(55)25-18-20-35(38(22-25)52(58)59)49-40-28-11-3-7-15-32(28)47-33-16-8-4-12-29(33)40)23-45-42(54)24-17-19-34(37(21-24)51(56)57)48-39-26-9-1-5-13-30(26)46-31-14-6-2-10-27(31)39/h1-22,36H,23H2,(H2,44,53)(H,45,54)(H,46,48)(H,47,49)(H,50,55) |
| InChIKey | XXOHQIDPOVWGEF-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 237.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.78 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|