C21H23N5O3 — CID 133309800
3-nitro-N-propan-2-yl-4-[2-(quinolin-2-ylamino)ethylamino]benzamide (PubChem CID 133309800) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-nitro-N-propan-2-yl-4-[2-(quinolin-2-ylamino)ethylamino]benzamide.
| Compound Name | 3-nitro-N-propan-2-yl-4-[2-(quinolin-2-ylamino)ethylamino]benzamide |
|---|---|
| PubChem CID | 133309800 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-nitro-N-propan-2-yl-4-[2-(quinolin-2-ylamino)ethylamino]benzamide |
| SMILES | CC(C)NC(=O)c1ccc(NCCNc2ccc3ccccc3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N5O3/c1-14(2)24-21(27)16-7-9-18(19(13-16)26(28)29)22-11-12-23-20-10-8-15-5-3-4-6-17(15)25-20/h3-10,13-14,22H,11-12H2,1-2H3,(H,23,25)(H,24,27) |
| InChIKey | JIWHFJYRDBXUNW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|