C22H20N6O3 — CID 133309783
(1-methylimidazol-2-yl)-[3-nitro-4-[2-(quinolin-2-ylamino)ethylamino]phenyl]methanone (PubChem CID 133309783) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[3-nitro-4-[2-(quinolin-2-ylamino)ethylamino]phenyl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[3-nitro-4-[2-(quinolin-2-ylamino)ethylamino]phenyl]methanone |
|---|---|
| PubChem CID | 133309783 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (1-methylimidazol-2-yl)-[3-nitro-4-[2-(quinolin-2-ylamino)ethylamino]phenyl]methanone |
| SMILES | Cn1ccnc1C(=O)c1ccc(NCCNc2ccc3ccccc3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N6O3/c1-27-13-12-25-22(27)21(29)16-6-8-18(19(14-16)28(30)31)23-10-11-24-20-9-7-15-4-2-3-5-17(15)26-20/h2-9,12-14,23H,10-11H2,1H3,(H,24,26) |
| InChIKey | QMQMTEWBIFCIQS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|