C46H37N9O7 — CID 52938081
4-(acridin-9-ylamino)-N-[6-[[4-(acridin-9-ylamino)-2-nitrobenzoyl]amino]-1-amino-1-oxohexan-2-yl]-3-nitrobenzamide (PubChem CID 52938081) has the molecular formula C46H37N9O7 and a molecular weight of 827.86 g/mol. Its IUPAC name is 4-(acridin-9-ylamino)-N-[6-[[4-(acridin-9-ylamino)-2-nitrobenzoyl]amino]-1-amino-1-oxohexan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-(acridin-9-ylamino)-N-[6-[[4-(acridin-9-ylamino)-2-nitrobenzoyl]amino]-1-amino-1-oxohexan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 52938081 |
| Molecular Formula | C46H37N9O7 |
| Molecular Weight | 827.86 g/mol |
| Exact Mass | 827.28 |
| IUPAC Name | 4-(acridin-9-ylamino)-N-[6-[[4-(acridin-9-ylamino)-2-nitrobenzoyl]amino]-1-amino-1-oxohexan-2-yl]-3-nitrobenzamide |
| SMILES | NC(=O)C(CCCCNC(=O)c1ccc(Nc2c3ccccc3nc3ccccc23)cc1[N+](=O)[O-])NC(=O)c1ccc(Nc2c3ccccc3nc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C46H37N9O7/c47-44(56)39(53-45(57)27-20-23-38(41(25-27)55(61)62)52-43-31-13-3-7-17-36(31)51-37-18-8-4-14-32(37)43)19-9-10-24-48-46(58)33-22-21-28(26-40(33)54(59)60)49-42-29-11-1-5-15-34(29)50-35-16-6-2-12-30(35)42/h1-8,11-18,20-23,25-26,39H,9-10,19,24H2,(H2,47,56)(H,48,58)(H,49,50)(H,51,52)(H,53,57) |
| InChIKey | QDDIZERNDDRDNU-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 237.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.86 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|