C48H38N6O7 — CID 160848745
4-(acridin-9-ylmethyl)-N-[6-[4-(acridin-9-ylmethyl)-3-nitrophenyl]-4-carbamoyl-6-oxohexyl]-3-nitrobenzamide (PubChem CID 160848745) has the molecular formula C48H38N6O7 and a molecular weight of 810.87 g/mol. Its IUPAC name is 4-(acridin-9-ylmethyl)-N-[6-[4-(acridin-9-ylmethyl)-3-nitrophenyl]-4-carbamoyl-6-oxohexyl]-3-nitrobenzamide.
| Compound Name | 4-(acridin-9-ylmethyl)-N-[6-[4-(acridin-9-ylmethyl)-3-nitrophenyl]-4-carbamoyl-6-oxohexyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 160848745 |
| Molecular Formula | C48H38N6O7 |
| Molecular Weight | 810.87 g/mol |
| Exact Mass | 810.28 |
| IUPAC Name | 4-(acridin-9-ylmethyl)-N-[6-[4-(acridin-9-ylmethyl)-3-nitrophenyl]-4-carbamoyl-6-oxohexyl]-3-nitrobenzamide |
| SMILES | NC(=O)C(CCCNC(=O)c1ccc(Cc2c3ccccc3nc3ccccc23)c([N+](=O)[O-])c1)CC(=O)c1ccc(Cc2c3ccccc3nc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C48H38N6O7/c49-47(56)32(28-46(55)31-21-19-29(44(26-31)53(58)59)24-38-34-11-1-5-15-40(34)51-41-16-6-2-12-35(38)41)10-9-23-50-48(57)33-22-20-30(45(27-33)54(60)61)25-39-36-13-3-7-17-42(36)52-43-18-8-4-14-37(39)43/h1-8,11-22,26-27,32H,9-10,23-25,28H2,(H2,49,56)(H,50,57) |
| InChIKey | SIZFYWLFKAPPLV-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 201.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.87 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|