C24H17N3O5 — CID 27309743
(4-carbamoyl-2-nitrophenyl)methyl 2-phenylquinoline-4-carboxylate (PubChem CID 27309743) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is (4-carbamoyl-2-nitrophenyl)methyl 2-phenylquinoline-4-carboxylate.
| Compound Name | (4-carbamoyl-2-nitrophenyl)methyl 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 27309743 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (4-carbamoyl-2-nitrophenyl)methyl 2-phenylquinoline-4-carboxylate |
| SMILES | NC(=O)c1ccc(COC(=O)c2cc(-c3ccccc3)nc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H17N3O5/c25-23(28)16-10-11-17(22(12-16)27(30)31)14-32-24(29)19-13-21(15-6-2-1-3-7-15)26-20-9-5-4-8-18(19)20/h1-13H,14H2,(H2,25,28) |
| InChIKey | DFWJEOOWGQVRIJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|