C17H17B2N5O11 — CID 156876058
[3-[[(2S)-1-amino-3-[(5-borono-2-nitrobenzoyl)amino]-1-oxopropan-2-yl]carbamoyl]-4-nitrophenyl]boronic acid (PubChem CID 156876058) has the molecular formula C17H17B2N5O11 and a molecular weight of 488.97 g/mol. Its IUPAC name is [3-[[(2S)-1-amino-3-[(5-borono-2-nitrobenzoyl)amino]-1-oxopropan-2-yl]carbamoyl]-4-nitrophenyl]boronic acid.
| Compound Name | [3-[[(2S)-1-amino-3-[(5-borono-2-nitrobenzoyl)amino]-1-oxopropan-2-yl]carbamoyl]-4-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 156876058 |
| Molecular Formula | C17H17B2N5O11 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | [3-[[(2S)-1-amino-3-[(5-borono-2-nitrobenzoyl)amino]-1-oxopropan-2-yl]carbamoyl]-4-nitrophenyl]boronic acid |
| SMILES | NC(=O)[C@H](CNC(=O)c1cc(B(O)O)ccc1[N+](=O)[O-])NC(=O)c1cc(B(O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17B2N5O11/c20-15(25)12(22-17(27)11-6-9(19(30)31)2-4-14(11)24(34)35)7-21-16(26)10-5-8(18(28)29)1-3-13(10)23(32)33/h1-6,12,28-31H,7H2,(H2,20,25)(H,21,26)(H,22,27)/t12-/m0/s1 |
| InChIKey | WDEYJTJBSBOESY-LBPRGKRZSA-N |
| XLogP | -4.12 |
| TPSA | 268.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|