C11H12F2N2O4 — CID 103769701
N-(3,3-difluoro-2-hydroxypropyl)-5-methyl-2-nitrobenzamide (PubChem CID 103769701) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-5-methyl-2-nitrobenzamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-5-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 103769701 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-5-methyl-2-nitrobenzamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(C(=O)NCC(O)C(F)F)c1 |
| InChI | InChI=1S/C11H12F2N2O4/c1-6-2-3-8(15(18)19)7(4-6)11(17)14-5-9(16)10(12)13/h2-4,9-10,16H,5H2,1H3,(H,14,17) |
| InChIKey | VLICIQPYWLDXGG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|