C15H21ClN2O3 — CID 106287129
N-(2-chloro-3-ethylpentyl)-5-methyl-2-nitrobenzamide (PubChem CID 106287129) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-(2-chloro-3-ethylpentyl)-5-methyl-2-nitrobenzamide.
| Compound Name | N-(2-chloro-3-ethylpentyl)-5-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 106287129 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(2-chloro-3-ethylpentyl)-5-methyl-2-nitrobenzamide |
| SMILES | CCC(CC)C(Cl)CNC(=O)c1cc(C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21ClN2O3/c1-4-11(5-2)13(16)9-17-15(19)12-8-10(3)6-7-14(12)18(20)21/h6-8,11,13H,4-5,9H2,1-3H3,(H,17,19) |
| InChIKey | KCHNXIWRBRRUGY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|