C17H21N3O4 — CID 11294835
N-[(2S)-2,6-diaminohexanoyl]-4-methyl-2-oxochromene-7-carboxamide (PubChem CID 11294835) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[(2S)-2,6-diaminohexanoyl]-4-methyl-2-oxochromene-7-carboxamide.
| Compound Name | N-[(2S)-2,6-diaminohexanoyl]-4-methyl-2-oxochromene-7-carboxamide |
|---|---|
| PubChem CID | 11294835 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[(2S)-2,6-diaminohexanoyl]-4-methyl-2-oxochromene-7-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(C(=O)NC(=O)[C@@H](N)CCCCN)ccc12 |
| InChI | InChI=1S/C17H21N3O4/c1-10-8-15(21)24-14-9-11(5-6-12(10)14)16(22)20-17(23)13(19)4-2-3-7-18/h5-6,8-9,13H,2-4,7,18-19H2,1H3,(H,20,22,23)/t13-/m0/s1 |
| InChIKey | BSPXBDPSNOTOPS-ZDUSSCGKSA-N |
| XLogP | 0.81 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|