C19H17NO4 — CID 155169638
N-[2-(4-hydroxyphenyl)ethyl]-4-methyl-2-oxochromene-7-carboxamide (PubChem CID 155169638) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-4-methyl-2-oxochromene-7-carboxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-4-methyl-2-oxochromene-7-carboxamide |
|---|---|
| PubChem CID | 155169638 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-4-methyl-2-oxochromene-7-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(C(=O)NCCc3ccc(O)cc3)ccc12 |
| InChI | InChI=1S/C19H17NO4/c1-12-10-18(22)24-17-11-14(4-7-16(12)17)19(23)20-9-8-13-2-5-15(21)6-3-13/h2-7,10-11,21H,8-9H2,1H3,(H,20,23) |
| InChIKey | GVQCEDRZEOQOAE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|