C15H16N2O3 — CID 171469459
N'-[2-(4-methyl-2-oxochromen-7-yl)ethyl]prop-2-enehydrazide (PubChem CID 171469459) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N'-[2-(4-methyl-2-oxochromen-7-yl)ethyl]prop-2-enehydrazide.
| Compound Name | N'-[2-(4-methyl-2-oxochromen-7-yl)ethyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 171469459 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N'-[2-(4-methyl-2-oxochromen-7-yl)ethyl]prop-2-enehydrazide |
| SMILES | C=CC(=O)NNCCc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C15H16N2O3/c1-3-14(18)17-16-7-6-11-4-5-12-10(2)8-15(19)20-13(12)9-11/h3-5,8-9,16H,1,6-7H2,2H3,(H,17,18) |
| InChIKey | KCTMECSWPIQCMZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|