C14H16O4 — CID 156779613
7-(4,4-dihydroxybutyl)-4-methylchromen-2-one (PubChem CID 156779613) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 7-(4,4-dihydroxybutyl)-4-methylchromen-2-one.
| Compound Name | 7-(4,4-dihydroxybutyl)-4-methylchromen-2-one |
|---|---|
| PubChem CID | 156779613 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 7-(4,4-dihydroxybutyl)-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(CCCC(O)O)ccc12 |
| InChI | InChI=1S/C14H16O4/c1-9-7-14(17)18-12-8-10(5-6-11(9)12)3-2-4-13(15)16/h5-8,13,15-16H,2-4H2,1H3 |
| InChIKey | UYTPIQKVLJZURS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|