C17H11BrO3 — CID 10545292
8-(bromomethyl)-4-methyl-[1]benzofuro[3,2-g]chromen-2-one (PubChem CID 10545292) has the molecular formula C17H11BrO3 and a molecular weight of 343.18 g/mol. Its IUPAC name is 8-(bromomethyl)-4-methyl-[1]benzofuro[3,2-g]chromen-2-one.
| Compound Name | 8-(bromomethyl)-4-methyl-[1]benzofuro[3,2-g]chromen-2-one |
|---|---|
| PubChem CID | 10545292 |
| Molecular Formula | C17H11BrO3 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 8-(bromomethyl)-4-methyl-[1]benzofuro[3,2-g]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc3oc4cc(CBr)ccc4c3cc12 |
| InChI | InChI=1S/C17H11BrO3/c1-9-4-17(19)21-15-7-16-13(6-12(9)15)11-3-2-10(8-18)5-14(11)20-16/h2-7H,8H2,1H3 |
| InChIKey | WOJDKYZTQBQYPM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|