About 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one
7-(bromomethyl)chromen-2-one;7-methylchromen-2-one (PubChem CID 160730215) has the molecular formula C20H15BrO4
and a molecular weight of 399.24 g/mol. Its IUPAC name is 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one.
Molecular Properties
| Compound Name | 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one |
| PubChem CID | 160730215 |
| Molecular Formula | C20H15BrO4 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one |
| SMILES | Cc1ccc2ccc(=O)oc2c1.O=c1ccc2ccc(CBr)cc2o1 |
| InChI | InChI=1S/C10H7BrO2.C10H8O2/c11-6-7-1-2-8-3-4-10(12)13-9(8)5-7;1-7-2-3-8-4-5-10(11)12-9(8)6-7/h1-5H,6H2;2-6H,1H3 |
| InChIKey | RUFUAULFMILKOW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one?
The IUPAC name of 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one (CID 160730215) is 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one.
What is the SMILES notation for 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one?
The canonical SMILES for 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one is Cc1ccc2ccc(=O)oc2c1.O=c1ccc2ccc(CBr)cc2o1.
What is the InChIKey of 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one?
The InChIKey is RUFUAULFMILKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO2.C10H8O2/c11-6-7-1-2-8-3-4-10(12)13-9(8)5-7;1-7-2-3-8-4-5-10(11)12-9(8)6-7/h1-5H,6H2;2-6H,1H3.
What are the key properties of 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one?
7-(bromomethyl)chromen-2-one;7-methylchromen-2-one has a molecular weight of 399.24 g/mol, XLogP of 4.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(bromomethyl)chromen-2-one;7-methylchromen-2-one is sourced from PubChem (CID 160730215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).