C18H21NO8 — CID 123284313
(4R,5R,6S,7R)-4-amino-5,6,7,8-tetrahydroxy-1-(4-methyl-2-oxochromen-7-yl)octane-2,3-dione (PubChem CID 123284313) has the molecular formula C18H21NO8 and a molecular weight of 379.37 g/mol. Its IUPAC name is (4R,5R,6S,7R)-4-amino-5,6,7,8-tetrahydroxy-1-(4-methyl-2-oxochromen-7-yl)octane-2,3-dione.
| Compound Name | (4R,5R,6S,7R)-4-amino-5,6,7,8-tetrahydroxy-1-(4-methyl-2-oxochromen-7-yl)octane-2,3-dione |
|---|---|
| PubChem CID | 123284313 |
| Molecular Formula | C18H21NO8 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (4R,5R,6S,7R)-4-amino-5,6,7,8-tetrahydroxy-1-(4-methyl-2-oxochromen-7-yl)octane-2,3-dione |
| SMILES | Cc1cc(=O)oc2cc(CC(=O)C(=O)[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO)ccc12 |
| InChI | InChI=1S/C18H21NO8/c1-8-4-14(23)27-13-6-9(2-3-10(8)13)5-11(21)16(24)15(19)18(26)17(25)12(22)7-20/h2-4,6,12,15,17-18,20,22,25-26H,5,7,19H2,1H3/t12-,15+,17-,18-/m1/s1 |
| InChIKey | STHRSGCHBBDQJC-UOAMXJAYSA-N |
| XLogP | -1.82 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|