C27H27N3O3 — CID 18962402
N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2-ethyl-4-oxopentanamide (PubChem CID 18962402) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2-ethyl-4-oxopentanamide.
| Compound Name | N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2-ethyl-4-oxopentanamide |
|---|---|
| PubChem CID | 18962402 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-2-ethyl-4-oxopentanamide |
| SMILES | CCC(CC(C)=O)C(=O)Nc1cc(CO)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-3-19(12-17(2)32)27(33)29-21-14-18(16-31)13-20(15-21)28-26-22-8-4-6-10-24(22)30-25-11-7-5-9-23(25)26/h4-11,13-15,19,31H,3,12,16H2,1-2H3,(H,28,30)(H,29,33) |
| InChIKey | QJEHVSRWMGPNIB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|