C32H33N3O5 — CID 18962406
N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)-2-(2-methyl-4-oxopentanoyl)phenyl]-2-methyl-4-oxopentanamide (PubChem CID 18962406) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)-2-(2-methyl-4-oxopentanoyl)phenyl]-2-methyl-4-oxopentanamide.
| Compound Name | N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)-2-(2-methyl-4-oxopentanoyl)phenyl]-2-methyl-4-oxopentanamide |
|---|---|
| PubChem CID | 18962406 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-[3-(acridin-9-ylamino)-5-(hydroxymethyl)-2-(2-methyl-4-oxopentanoyl)phenyl]-2-methyl-4-oxopentanamide |
| SMILES | CC(=O)CC(C)C(=O)Nc1cc(CO)cc(Nc2c3ccccc3nc3ccccc23)c1C(=O)C(C)CC(C)=O |
| InChI | InChI=1S/C32H33N3O5/c1-18(13-20(3)37)31(39)29-27(15-22(17-36)16-28(29)35-32(40)19(2)14-21(4)38)34-30-23-9-5-7-11-25(23)33-26-12-8-6-10-24(26)30/h5-12,15-16,18-19,36H,13-14,17H2,1-4H3,(H,33,34)(H,35,40) |
| InChIKey | QJQKRXRMTHHECI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|