About methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride
methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride (PubChem CID 138402094) has the molecular formula C21H18ClN3O2
and a molecular weight of 379.85 g/mol. Its IUPAC name is methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride.
Molecular Properties
| Compound Name | methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride |
| PubChem CID | 138402094 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride |
| SMILES | COC(=O)Nc1ccccc1Nc1c2ccccc2nc2ccccc12.Cl |
| InChI | InChI=1S/C21H17N3O2.ClH/c1-26-21(25)24-19-13-7-6-12-18(19)23-20-14-8-2-4-10-16(14)22-17-11-5-3-9-15(17)20;/h2-13H,1H3,(H,22,23)(H,24,25);1H |
| InChIKey | ZEALPNOJOFORKF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride?
The IUPAC name of methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride (CID 138402094) is methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride.
What is the SMILES notation for methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride?
The canonical SMILES for methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride is COC(=O)Nc1ccccc1Nc1c2ccccc2nc2ccccc12.Cl.
What is the InChIKey of methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride?
The InChIKey is ZEALPNOJOFORKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O2.ClH/c1-26-21(25)24-19-13-7-6-12-18(19)23-20-14-8-2-4-10-16(14)22-17-11-5-3-9-15(17)20;/h2-13H,1H3,(H,22,23)(H,24,25);1H.
What are the key properties of methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride?
methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride has a molecular weight of 379.85 g/mol, XLogP of 5.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(acridin-9-ylamino)phenyl]carbamate;hydrochloride is sourced from PubChem (CID 138402094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).